Triethylene glycol diacrylate
Catalog No: FT-0633765
CAS No: 1680-21-3
- Chemical Name: Triethylene glycol diacrylate
- Molecular Formula: C12H18O6
- Molecular Weight: 258.27
- InChI Key: INQDDHNZXOAFFD-UHFFFAOYSA-N
- InChI: InChI=1S/C12H18O6/c1-3-11(13)17-9-7-15-5-6-16-8-10-18-12(14)4-2/h3-4H,1-2,5-10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 258.26800 |
|---|---|
| CAS: | 1680-21-3 |
| Flash_Point: | 146.6ºC |
| MF: | C12H18O6 |
| Symbol: | Warning |
| Bolling_Point: | 338.9ºCat 760 mmHg |
| Melting_Point: | N/A |
| Product_Name: | 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate |
| Density: | 1.092 g/cm3 |
| FW: | 258.26800 |
|---|---|
| MF: | C12H18O6 |
| Exact_Mass: | 258.11000 |
| Bolling_Point: | 338.9ºCat 760 mmHg |
| Refractive_Index: | 1.454 |
| PSA: | 71.06000 |
| LogP: | 0.47800 |
| Flash_Point: | 146.6ºC |
| Density: | 1.092 g/cm3 |
| Vapor_Pressure: | 9.54E-05mmHg at 25°C |
| RTECS: | AS8150000 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H315-H317-H319 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2918990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)